C11H16N2OS — CID 115088763
1-[2-(piperidin-2-ylmethyl)-1,3-thiazol-4-yl]ethanone (PubChem CID 115088763) has the molecular formula C11H16N2OS and a molecular weight of 224.33 g/mol. Its IUPAC name is 1-[2-(piperidin-2-ylmethyl)-1,3-thiazol-4-yl]ethanone.
| Compound Name | 1-[2-(piperidin-2-ylmethyl)-1,3-thiazol-4-yl]ethanone |
|---|---|
| PubChem CID | 115088763 |
| Molecular Formula | C11H16N2OS |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 1-[2-(piperidin-2-ylmethyl)-1,3-thiazol-4-yl]ethanone |
| SMILES | CC(=O)c1csc(CC2CCCCN2)n1 |
| InChI | InChI=1S/C11H16N2OS/c1-8(14)10-7-15-11(13-10)6-9-4-2-3-5-12-9/h7,9,12H,2-6H2,1H3 |
| InChIKey | GSWULXWCMJSAPC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |