About 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-7H-purin-6-amine
8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-7H-purin-6-amine (PubChem CID 11508877) has the molecular formula C13H9BrFN5O2
and a molecular weight of 366.15 g/mol. Its IUPAC name is 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-7H-purin-6-amine.
Molecular Properties
| Compound Name | 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-7H-purin-6-amine |
| PubChem CID | 11508877 |
| Molecular Formula | C13H9BrFN5O2 |
| Molecular Weight | 366.15 g/mol |
| Exact Mass | 364.99 |
| IUPAC Name | 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-7H-purin-6-amine |
| SMILES | Nc1nc(F)nc2nc(Cc3cc4c(cc3Br)OCO4)[nH]c12 |
| InChI | InChI=1S/C13H9BrFN5O2/c14-6-3-8-7(21-4-22-8)1-5(6)2-9-17-10-11(16)19-13(15)20-12(10)18-9/h1,3H,2,4H2,(H3,16,17,18,19,20) |
| InChIKey | NCZUSALSTMUXOF-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 98.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.15 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-7H-purin-6-amine?
The IUPAC name of 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-7H-purin-6-amine (CID 11508877) is 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-7H-purin-6-amine.
What is the SMILES notation for 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-7H-purin-6-amine?
The canonical SMILES for 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-7H-purin-6-amine is Nc1nc(F)nc2nc(Cc3cc4c(cc3Br)OCO4)[nH]c12.
What is the InChIKey of 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-7H-purin-6-amine?
The InChIKey is NCZUSALSTMUXOF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9BrFN5O2/c14-6-3-8-7(21-4-22-8)1-5(6)2-9-17-10-11(16)19-13(15)20-12(10)18-9/h1,3H,2,4H2,(H3,16,17,18,19,20).
What are the key properties of 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-7H-purin-6-amine?
8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-7H-purin-6-amine has a molecular weight of 366.15 g/mol, XLogP of 2.16, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(6-bromo-1,3-benzodioxol-5-yl)methyl]-2-fluoro-7H-purin-6-amine is sourced from PubChem (CID 11508877), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).