C23H26FNO2 — CID 11508904
(2-fluoro-6-propyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl) 2-methylpropanoate (PubChem CID 11508904) has the molecular formula C23H26FNO2 and a molecular weight of 367.46 g/mol. Its IUPAC name is (2-fluoro-6-propyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl) 2-methylpropanoate.
| Compound Name | (2-fluoro-6-propyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl) 2-methylpropanoate |
|---|---|
| PubChem CID | 11508904 |
| Molecular Formula | C23H26FNO2 |
| Molecular Weight | 367.46 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | (2-fluoro-6-propyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-11-yl) 2-methylpropanoate |
| SMILES | CCCN1CCc2cc(F)cc3c2C1Cc1cccc(OC(=O)C(C)C)c1-3 |
| InChI | InChI=1S/C23H26FNO2/c1-4-9-25-10-8-16-11-17(24)13-18-21(16)19(25)12-15-6-5-7-20(22(15)18)27-23(26)14(2)3/h5-7,11,13-14,19H,4,8-10,12H2,1-3H3 |
| InChIKey | WUHNFMZHQAEZAD-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.46 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|