C22H27ClN2O — CID 11508979
(3aR,9bS)-8-ethyl-6-methyl-4-(2-phenylethyl)-2,3,3a,9b-tetrahydro-1H-pyrrolo[3,4-c]isoquinolin-5-one;hydrochloride (PubChem CID 11508979) has the molecular formula C22H27ClN2O and a molecular weight of 370.92 g/mol. Its IUPAC name is (3aR,9bS)-8-ethyl-6-methyl-4-(2-phenylethyl)-2,3,3a,9b-tetrahydro-1H-pyrrolo[3,4-c]isoquinolin-5-one;hydrochloride.
| Compound Name | (3aR,9bS)-8-ethyl-6-methyl-4-(2-phenylethyl)-2,3,3a,9b-tetrahydro-1H-pyrrolo[3,4-c]isoquinolin-5-one;hydrochloride |
|---|---|
| PubChem CID | 11508979 |
| Molecular Formula | C22H27ClN2O |
| Molecular Weight | 370.92 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | (3aR,9bS)-8-ethyl-6-methyl-4-(2-phenylethyl)-2,3,3a,9b-tetrahydro-1H-pyrrolo[3,4-c]isoquinolin-5-one;hydrochloride |
| SMILES | CCc1cc(C)c2c(c1)[C@H]1CNC[C@@H]1N(CCc1ccccc1)C2=O.Cl |
| InChI | InChI=1S/C22H26N2O.ClH/c1-3-16-11-15(2)21-18(12-16)19-13-23-14-20(19)24(22(21)25)10-9-17-7-5-4-6-8-17;/h4-8,11-12,19-20,23H,3,9-10,13-14H2,1-2H3;1H/t19-,20+;/m1./s1 |
| InChIKey | QFBNRDRYKYOMEP-FDOHDBATSA-N |
| XLogP | 3.73 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.92 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |