C14H14ClF3N4 — CID 11509091
N-(3-chlorophenyl)-5-[(dimethylamino)methyl]-4-(trifluoromethyl)pyrimidin-2-amine (PubChem CID 11509091) has the molecular formula C14H14ClF3N4 and a molecular weight of 330.74 g/mol. Its IUPAC name is N-(3-chlorophenyl)-5-[(dimethylamino)methyl]-4-(trifluoromethyl)pyrimidin-2-amine.
| Compound Name | N-(3-chlorophenyl)-5-[(dimethylamino)methyl]-4-(trifluoromethyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 11509091 |
| Molecular Formula | C14H14ClF3N4 |
| Molecular Weight | 330.74 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | N-(3-chlorophenyl)-5-[(dimethylamino)methyl]-4-(trifluoromethyl)pyrimidin-2-amine |
| SMILES | CN(C)Cc1cnc(Nc2cccc(Cl)c2)nc1C(F)(F)F |
| InChI | InChI=1S/C14H14ClF3N4/c1-22(2)8-9-7-19-13(21-12(9)14(16,17)18)20-11-5-3-4-10(15)6-11/h3-7H,8H2,1-2H3,(H,19,20,21) |
| InChIKey | KDRWNISQDHVFCP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.74 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |