3-[2-(5-bromofuran-2-yl)-1,3-thiazol-5-yl]propanoic acid

C10H8BrNO3S — CID 115091320

IUPAC3-[2-(5-bromofuran-2-yl)-1,3-thiazol-5-yl]propanoic acid
SMILESO=C(O)CCc1cnc(-c2ccc(Br)o2)s1
InChIInChI=1S/C10H8BrNO3S/c11-8-3-2-7(15-8)10-12-5-6(16-10)1-4-9(13)14/h2-3,5H,1,4H2,(H,13,14)
InChIKeyILGKKABNVUQXRP-UHFFFAOYSA-N
MW302.15 g/mol
LogP3.18
Rot. Bonds4

About 3-[2-(5-bromofuran-2-yl)-1,3-thiazol-5-yl]propanoic acid

3-[2-(5-bromofuran-2-yl)-1,3-thiazol-5-yl]propanoic acid (PubChem CID 115091320) has the molecular formula C10H8BrNO3S and a molecular weight of 302.15 g/mol. Its IUPAC name is 3-[2-(5-bromofuran-2-yl)-1,3-thiazol-5-yl]propanoic acid.

Molecular Properties

Compound Name3-[2-(5-bromofuran-2-yl)-1,3-thiazol-5-yl]propanoic acid
PubChem CID115091320
Molecular FormulaC10H8BrNO3S
Molecular Weight302.15 g/mol
Exact Mass300.94
IUPAC Name3-[2-(5-bromofuran-2-yl)-1,3-thiazol-5-yl]propanoic acid
SMILESO=C(O)CCc1cnc(-c2ccc(Br)o2)s1
InChIInChI=1S/C10H8BrNO3S/c11-8-3-2-7(15-8)10-12-5-6(16-10)1-4-9(13)14/h2-3,5H,1,4H2,(H,13,14)
InChIKeyILGKKABNVUQXRP-UHFFFAOYSA-N
XLogP3.18
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500302.15
LogP ≤ 53.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[2-(5-bromofuran-2-yl)-1,3-thiazol-5-yl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[2-(5-bromofuran-2-yl)-1,3-thiazol-5-yl]propanoic acid?
The IUPAC name of 3-[2-(5-bromofuran-2-yl)-1,3-thiazol-5-yl]propanoic acid (CID 115091320) is 3-[2-(5-bromofuran-2-yl)-1,3-thiazol-5-yl]propanoic acid.
What is the SMILES notation for 3-[2-(5-bromofuran-2-yl)-1,3-thiazol-5-yl]propanoic acid?
The canonical SMILES for 3-[2-(5-bromofuran-2-yl)-1,3-thiazol-5-yl]propanoic acid is O=C(O)CCc1cnc(-c2ccc(Br)o2)s1.
What is the InChIKey of 3-[2-(5-bromofuran-2-yl)-1,3-thiazol-5-yl]propanoic acid?
The InChIKey is ILGKKABNVUQXRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8BrNO3S/c11-8-3-2-7(15-8)10-12-5-6(16-10)1-4-9(13)14/h2-3,5H,1,4H2,(H,13,14).
What are the key properties of 3-[2-(5-bromofuran-2-yl)-1,3-thiazol-5-yl]propanoic acid?
3-[2-(5-bromofuran-2-yl)-1,3-thiazol-5-yl]propanoic acid has a molecular weight of 302.15 g/mol, XLogP of 3.18, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(5-bromofuran-2-yl)-1,3-thiazol-5-yl]propanoic acid is sourced from PubChem (CID 115091320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).