C15H17F3N2S — CID 115091428
N-methyl-3-[2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-5-yl]propan-1-amine (PubChem CID 115091428) has the molecular formula C15H17F3N2S and a molecular weight of 314.38 g/mol. Its IUPAC name is N-methyl-3-[2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-5-yl]propan-1-amine.
| Compound Name | N-methyl-3-[2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-5-yl]propan-1-amine |
|---|---|
| PubChem CID | 115091428 |
| Molecular Formula | C15H17F3N2S |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-methyl-3-[2-[[3-(trifluoromethyl)phenyl]methyl]-1,3-thiazol-5-yl]propan-1-amine |
| SMILES | CNCCCc1cnc(Cc2cccc(C(F)(F)F)c2)s1 |
| InChI | InChI=1S/C15H17F3N2S/c1-19-7-3-6-13-10-20-14(21-13)9-11-4-2-5-12(8-11)15(16,17)18/h2,4-5,8,10,19H,3,6-7,9H2,1H3 |
| InChIKey | CAVBGAVWGQIPBA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|