About O-tert-butyl 3-amino-5-[2-(dimethylamino)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carbothioate
O-tert-butyl 3-amino-5-[2-(dimethylamino)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carbothioate (PubChem CID 11509195) has the molecular formula C18H27N3O2S2
and a molecular weight of 381.57 g/mol. Its IUPAC name is O-tert-butyl 3-amino-5-[2-(dimethylamino)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carbothioate.
Molecular Properties
| Compound Name | O-tert-butyl 3-amino-5-[2-(dimethylamino)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carbothioate |
| PubChem CID | 11509195 |
| Molecular Formula | C18H27N3O2S2 |
| Molecular Weight | 381.57 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | O-tert-butyl 3-amino-5-[2-(dimethylamino)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carbothioate |
| SMILES | Cc1nc2sc(C(=S)OC(C)(C)C)c(N)c2c(C)c1OCCN(C)C |
| InChI | InChI=1S/C18H27N3O2S2/c1-10-12-13(19)15(17(24)23-18(3,4)5)25-16(12)20-11(2)14(10)22-9-8-21(6)7/h8-9,19H2,1-7H3 |
| InChIKey | GWYDWKYIKBJITL-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 60.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.57 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-tert-butyl 3-amino-5-[2-(dimethylamino)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carbothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-tert-butyl 3-amino-5-[2-(dimethylamino)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carbothioate?
The IUPAC name of O-tert-butyl 3-amino-5-[2-(dimethylamino)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carbothioate (CID 11509195) is O-tert-butyl 3-amino-5-[2-(dimethylamino)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carbothioate.
What is the SMILES notation for O-tert-butyl 3-amino-5-[2-(dimethylamino)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carbothioate?
The canonical SMILES for O-tert-butyl 3-amino-5-[2-(dimethylamino)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carbothioate is Cc1nc2sc(C(=S)OC(C)(C)C)c(N)c2c(C)c1OCCN(C)C.
What is the InChIKey of O-tert-butyl 3-amino-5-[2-(dimethylamino)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carbothioate?
The InChIKey is GWYDWKYIKBJITL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3O2S2/c1-10-12-13(19)15(17(24)23-18(3,4)5)25-16(12)20-11(2)14(10)22-9-8-21(6)7/h8-9,19H2,1-7H3.
What are the key properties of O-tert-butyl 3-amino-5-[2-(dimethylamino)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carbothioate?
O-tert-butyl 3-amino-5-[2-(dimethylamino)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carbothioate has a molecular weight of 381.57 g/mol, XLogP of 3.93, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for O-tert-butyl 3-amino-5-[2-(dimethylamino)ethoxy]-4,6-dimethylthieno[2,3-b]pyridine-2-carbothioate is sourced from PubChem (CID 11509195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).