C20H18N2O4S — CID 11509211
(E)-N-cyclopentyl-3-[5-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-1-benzofuran-3-yl]prop-2-enamide (PubChem CID 11509211) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is (E)-N-cyclopentyl-3-[5-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-1-benzofuran-3-yl]prop-2-enamide.
| Compound Name | (E)-N-cyclopentyl-3-[5-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-1-benzofuran-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 11509211 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | (E)-N-cyclopentyl-3-[5-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]-1-benzofuran-3-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1coc2ccc(/C=C3\SC(=O)NC3=O)cc12)NC1CCCC1 |
| InChI | InChI=1S/C20H18N2O4S/c23-18(21-14-3-1-2-4-14)8-6-13-11-26-16-7-5-12(9-15(13)16)10-17-19(24)22-20(25)27-17/h5-11,14H,1-4H2,(H,21,23)(H,22,24,25)/b8-6+,17-10- |
| InChIKey | JMRBDQRQZKRSDB-CYPPJGAXSA-N |
| XLogP | 3.83 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|