C11H16N2O2 — CID 115092483
1-[1-methyl-3-(oxan-3-yl)pyrazol-5-yl]ethanone (PubChem CID 115092483) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-[1-methyl-3-(oxan-3-yl)pyrazol-5-yl]ethanone.
| Compound Name | 1-[1-methyl-3-(oxan-3-yl)pyrazol-5-yl]ethanone |
|---|---|
| PubChem CID | 115092483 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | 1-[1-methyl-3-(oxan-3-yl)pyrazol-5-yl]ethanone |
| SMILES | CC(=O)c1cc(C2CCCOC2)nn1C |
| InChI | InChI=1S/C11H16N2O2/c1-8(14)11-6-10(12-13(11)2)9-4-3-5-15-7-9/h6,9H,3-5,7H2,1-2H3 |
| InChIKey | WJJRHXRQOSFYKH-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |