C21H26O5S — CID 11509368
(1R,2S,3R,4R,6R)-4-(hydroxymethyl)-6-[2-[(4-methylsulfanylphenyl)methyl]phenoxy]cyclohexane-1,2,3-triol (PubChem CID 11509368) has the molecular formula C21H26O5S and a molecular weight of 390.50 g/mol. Its IUPAC name is (1R,2S,3R,4R,6R)-4-(hydroxymethyl)-6-[2-[(4-methylsulfanylphenyl)methyl]phenoxy]cyclohexane-1,2,3-triol.
| Compound Name | (1R,2S,3R,4R,6R)-4-(hydroxymethyl)-6-[2-[(4-methylsulfanylphenyl)methyl]phenoxy]cyclohexane-1,2,3-triol |
|---|---|
| PubChem CID | 11509368 |
| Molecular Formula | C21H26O5S |
| Molecular Weight | 390.50 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | (1R,2S,3R,4R,6R)-4-(hydroxymethyl)-6-[2-[(4-methylsulfanylphenyl)methyl]phenoxy]cyclohexane-1,2,3-triol |
| SMILES | CSc1ccc(Cc2ccccc2O[C@@H]2C[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1 |
| InChI | InChI=1S/C21H26O5S/c1-27-16-8-6-13(7-9-16)10-14-4-2-3-5-17(14)26-18-11-15(12-22)19(23)21(25)20(18)24/h2-9,15,18-25H,10-12H2,1H3/t15-,18-,19-,20+,21+/m1/s1 |
| InChIKey | IWLRPHUUXHUFKI-WIGAVFHRSA-N |
| XLogP | 1.84 |
| TPSA | 90.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.50 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |