C11H18N2O2 — CID 115093813
[5-(2-piperidin-1-ylethyl)-1,2-oxazol-4-yl]methanol (PubChem CID 115093813) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is [5-(2-piperidin-1-ylethyl)-1,2-oxazol-4-yl]methanol.
| Compound Name | [5-(2-piperidin-1-ylethyl)-1,2-oxazol-4-yl]methanol |
|---|---|
| PubChem CID | 115093813 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | [5-(2-piperidin-1-ylethyl)-1,2-oxazol-4-yl]methanol |
| SMILES | OCc1cnoc1CCN1CCCCC1 |
| InChI | InChI=1S/C11H18N2O2/c14-9-10-8-12-15-11(10)4-7-13-5-2-1-3-6-13/h8,14H,1-7,9H2 |
| InChIKey | JEOCQBPTGJLUCD-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 49.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |