About 2-(3-amino-1,2-oxazol-5-yl)ethanol
2-(3-amino-1,2-oxazol-5-yl)ethanol (PubChem CID 115093841) has the molecular formula C5H8N2O2
and a molecular weight of 128.13 g/mol. Its IUPAC name is 2-(3-amino-1,2-oxazol-5-yl)ethanol.
Molecular Properties
| Compound Name | 2-(3-amino-1,2-oxazol-5-yl)ethanol |
| PubChem CID | 115093841 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 2-(3-amino-1,2-oxazol-5-yl)ethanol |
| SMILES | Nc1cc(CCO)on1 |
| InChI | InChI=1S/C5H8N2O2/c6-5-3-4(1-2-8)9-7-5/h3,8H,1-2H2,(H2,6,7) |
| InChIKey | TUQGJDXSAUUIHX-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-amino-1,2-oxazol-5-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-amino-1,2-oxazol-5-yl)ethanol?
The IUPAC name of 2-(3-amino-1,2-oxazol-5-yl)ethanol (CID 115093841) is 2-(3-amino-1,2-oxazol-5-yl)ethanol.
What is the SMILES notation for 2-(3-amino-1,2-oxazol-5-yl)ethanol?
The canonical SMILES for 2-(3-amino-1,2-oxazol-5-yl)ethanol is Nc1cc(CCO)on1.
What is the InChIKey of 2-(3-amino-1,2-oxazol-5-yl)ethanol?
The InChIKey is TUQGJDXSAUUIHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O2/c6-5-3-4(1-2-8)9-7-5/h3,8H,1-2H2,(H2,6,7).
What are the key properties of 2-(3-amino-1,2-oxazol-5-yl)ethanol?
2-(3-amino-1,2-oxazol-5-yl)ethanol has a molecular weight of 128.13 g/mol, XLogP of -0.21, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-amino-1,2-oxazol-5-yl)ethanol is sourced from PubChem (CID 115093841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).