C23H32N6 — CID 11509406
N,N,N'-trimethyl-N'-[2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-1H-benzimidazol-4-yl]ethane-1,2-diamine (PubChem CID 11509406) has the molecular formula C23H32N6 and a molecular weight of 392.55 g/mol. Its IUPAC name is N,N,N'-trimethyl-N'-[2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-1H-benzimidazol-4-yl]ethane-1,2-diamine.
| Compound Name | N,N,N'-trimethyl-N'-[2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-1H-benzimidazol-4-yl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 11509406 |
| Molecular Formula | C23H32N6 |
| Molecular Weight | 392.55 g/mol |
| Exact Mass | 392.27 |
| IUPAC Name | N,N,N'-trimethyl-N'-[2-[[methyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]-1H-benzimidazol-4-yl]ethane-1,2-diamine |
| SMILES | CN(C)CCN(C)c1cccc2[nH]c(CN(C)C3CCCc4cccnc43)nc12 |
| InChI | InChI=1S/C23H32N6/c1-27(2)14-15-28(3)20-12-6-10-18-23(20)26-21(25-18)16-29(4)19-11-5-8-17-9-7-13-24-22(17)19/h6-7,9-10,12-13,19H,5,8,11,14-16H2,1-4H3,(H,25,26) |
| InChIKey | ITWVSYDHQQETDY-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 51.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |