About 5-[(1-propan-2-ylpyrrolidin-2-yl)methyl]-1,2-oxazole-3-carbaldehyde
5-[(1-propan-2-ylpyrrolidin-2-yl)methyl]-1,2-oxazole-3-carbaldehyde (PubChem CID 115094138) has the molecular formula C12H18N2O2
and a molecular weight of 222.29 g/mol. Its IUPAC name is 5-[(1-propan-2-ylpyrrolidin-2-yl)methyl]-1,2-oxazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 5-[(1-propan-2-ylpyrrolidin-2-yl)methyl]-1,2-oxazole-3-carbaldehyde |
| PubChem CID | 115094138 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | 5-[(1-propan-2-ylpyrrolidin-2-yl)methyl]-1,2-oxazole-3-carbaldehyde |
| SMILES | CC(C)N1CCCC1Cc1cc(C=O)no1 |
| InChI | InChI=1S/C12H18N2O2/c1-9(2)14-5-3-4-11(14)7-12-6-10(8-15)13-16-12/h6,8-9,11H,3-5,7H2,1-2H3 |
| InChIKey | XIAZLYJIFRDMRS-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-[(1-propan-2-ylpyrrolidin-2-yl)methyl]-1,2-oxazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1-propan-2-ylpyrrolidin-2-yl)methyl]-1,2-oxazole-3-carbaldehyde?
The IUPAC name of 5-[(1-propan-2-ylpyrrolidin-2-yl)methyl]-1,2-oxazole-3-carbaldehyde (CID 115094138) is 5-[(1-propan-2-ylpyrrolidin-2-yl)methyl]-1,2-oxazole-3-carbaldehyde.
What is the SMILES notation for 5-[(1-propan-2-ylpyrrolidin-2-yl)methyl]-1,2-oxazole-3-carbaldehyde?
The canonical SMILES for 5-[(1-propan-2-ylpyrrolidin-2-yl)methyl]-1,2-oxazole-3-carbaldehyde is CC(C)N1CCCC1Cc1cc(C=O)no1.
What is the InChIKey of 5-[(1-propan-2-ylpyrrolidin-2-yl)methyl]-1,2-oxazole-3-carbaldehyde?
The InChIKey is XIAZLYJIFRDMRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O2/c1-9(2)14-5-3-4-11(14)7-12-6-10(8-15)13-16-12/h6,8-9,11H,3-5,7H2,1-2H3.
What are the key properties of 5-[(1-propan-2-ylpyrrolidin-2-yl)methyl]-1,2-oxazole-3-carbaldehyde?
5-[(1-propan-2-ylpyrrolidin-2-yl)methyl]-1,2-oxazole-3-carbaldehyde has a molecular weight of 222.29 g/mol, XLogP of 1.90, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1-propan-2-ylpyrrolidin-2-yl)methyl]-1,2-oxazole-3-carbaldehyde is sourced from PubChem (CID 115094138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).