About 1-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]ethanone
1-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]ethanone (PubChem CID 115094350) has the molecular formula C11H8FNO2
and a molecular weight of 205.19 g/mol. Its IUPAC name is 1-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]ethanone.
Molecular Properties
| Compound Name | 1-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]ethanone |
| PubChem CID | 115094350 |
| Molecular Formula | C11H8FNO2 |
| Molecular Weight | 205.19 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 1-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]ethanone |
| SMILES | CC(=O)c1cc(-c2ccccc2F)on1 |
| InChI | InChI=1S/C11H8FNO2/c1-7(14)10-6-11(15-13-10)8-4-2-3-5-9(8)12/h2-6H,1H3 |
| InChIKey | IAEPVGXYFIKJOK-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.19 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]ethanone?
The IUPAC name of 1-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]ethanone (CID 115094350) is 1-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]ethanone.
What is the SMILES notation for 1-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]ethanone?
The canonical SMILES for 1-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]ethanone is CC(=O)c1cc(-c2ccccc2F)on1.
What is the InChIKey of 1-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]ethanone?
The InChIKey is IAEPVGXYFIKJOK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8FNO2/c1-7(14)10-6-11(15-13-10)8-4-2-3-5-9(8)12/h2-6H,1H3.
What are the key properties of 1-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]ethanone?
1-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]ethanone has a molecular weight of 205.19 g/mol, XLogP of 2.68, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(2-fluorophenyl)-1,2-oxazol-3-yl]ethanone is sourced from PubChem (CID 115094350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).