About 5-cyclobutyl-1,2-oxazole-3-carbaldehyde
5-cyclobutyl-1,2-oxazole-3-carbaldehyde (PubChem CID 115094358) has the molecular formula C8H9NO2
and a molecular weight of 151.17 g/mol. Its IUPAC name is 5-cyclobutyl-1,2-oxazole-3-carbaldehyde.
Molecular Properties
| Compound Name | 5-cyclobutyl-1,2-oxazole-3-carbaldehyde |
| PubChem CID | 115094358 |
| Molecular Formula | C8H9NO2 |
| Molecular Weight | 151.17 g/mol |
| Exact Mass | 151.06 |
| IUPAC Name | 5-cyclobutyl-1,2-oxazole-3-carbaldehyde |
| SMILES | O=Cc1cc(C2CCC2)on1 |
| InChI | InChI=1S/C8H9NO2/c10-5-7-4-8(11-9-7)6-2-1-3-6/h4-6H,1-3H2 |
| InChIKey | MJBZHEDJMULHPJ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.17 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclobutyl-1,2-oxazole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclobutyl-1,2-oxazole-3-carbaldehyde?
The IUPAC name of 5-cyclobutyl-1,2-oxazole-3-carbaldehyde (CID 115094358) is 5-cyclobutyl-1,2-oxazole-3-carbaldehyde.
What is the SMILES notation for 5-cyclobutyl-1,2-oxazole-3-carbaldehyde?
The canonical SMILES for 5-cyclobutyl-1,2-oxazole-3-carbaldehyde is O=Cc1cc(C2CCC2)on1.
What is the InChIKey of 5-cyclobutyl-1,2-oxazole-3-carbaldehyde?
The InChIKey is MJBZHEDJMULHPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO2/c10-5-7-4-8(11-9-7)6-2-1-3-6/h4-6H,1-3H2.
What are the key properties of 5-cyclobutyl-1,2-oxazole-3-carbaldehyde?
5-cyclobutyl-1,2-oxazole-3-carbaldehyde has a molecular weight of 151.17 g/mol, XLogP of 1.75, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclobutyl-1,2-oxazole-3-carbaldehyde is sourced from PubChem (CID 115094358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).