C22H38O4Si — CID 11509444
(1R,2R,3E,7S,11E,13S,15S)-2-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-7-methyl-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one (PubChem CID 11509444) has the molecular formula C22H38O4Si and a molecular weight of 394.63 g/mol. Its IUPAC name is (1R,2R,3E,7S,11E,13S,15S)-2-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-7-methyl-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one.
| Compound Name | (1R,2R,3E,7S,11E,13S,15S)-2-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-7-methyl-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one |
|---|---|
| PubChem CID | 11509444 |
| Molecular Formula | C22H38O4Si |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | (1R,2R,3E,7S,11E,13S,15S)-2-[tert-butyl(dimethyl)silyl]oxy-15-hydroxy-7-methyl-6-oxabicyclo[11.3.0]hexadeca-3,11-dien-5-one |
| SMILES | C[C@H]1CCC/C=C/[C@@H]2C[C@H](O)C[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)/C=C/C(=O)O1 |
| InChI | InChI=1S/C22H38O4Si/c1-16-10-8-7-9-11-17-14-18(23)15-19(17)20(12-13-21(24)25-16)26-27(5,6)22(2,3)4/h9,11-13,16-20,23H,7-8,10,14-15H2,1-6H3/b11-9+,13-12+/t16-,17+,18-,19+,20+/m0/s1 |
| InChIKey | LTVFSGBAMKAWNY-OHOWTJHZSA-N |
| XLogP | 4.99 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|