C10H18O3S — CID 115094471
[2-(thian-4-ylmethyl)-1,3-dioxolan-4-yl]methanol (PubChem CID 115094471) has the molecular formula C10H18O3S and a molecular weight of 218.32 g/mol. Its IUPAC name is [2-(thian-4-ylmethyl)-1,3-dioxolan-4-yl]methanol.
| Compound Name | [2-(thian-4-ylmethyl)-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 115094471 |
| Molecular Formula | C10H18O3S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | [2-(thian-4-ylmethyl)-1,3-dioxolan-4-yl]methanol |
| SMILES | OCC1COC(CC2CCSCC2)O1 |
| InChI | InChI=1S/C10H18O3S/c11-6-9-7-12-10(13-9)5-8-1-3-14-4-2-8/h8-11H,1-7H2 |
| InChIKey | RMGFJTHNKFKEMI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |