C10H20N2O2 — CID 115094596
[2-(piperidin-3-ylmethyl)-1,3-dioxolan-4-yl]methanamine (PubChem CID 115094596) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is [2-(piperidin-3-ylmethyl)-1,3-dioxolan-4-yl]methanamine.
| Compound Name | [2-(piperidin-3-ylmethyl)-1,3-dioxolan-4-yl]methanamine |
|---|---|
| PubChem CID | 115094596 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | [2-(piperidin-3-ylmethyl)-1,3-dioxolan-4-yl]methanamine |
| SMILES | NCC1COC(CC2CCCNC2)O1 |
| InChI | InChI=1S/C10H20N2O2/c11-5-9-7-13-10(14-9)4-8-2-1-3-12-6-8/h8-10,12H,1-7,11H2 |
| InChIKey | HSHSKHSPYCIAKC-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |