C9H12O3S — CID 115094617
[2-(5-methylthiophen-2-yl)-1,3-dioxolan-4-yl]methanol (PubChem CID 115094617) has the molecular formula C9H12O3S and a molecular weight of 200.26 g/mol. Its IUPAC name is [2-(5-methylthiophen-2-yl)-1,3-dioxolan-4-yl]methanol.
| Compound Name | [2-(5-methylthiophen-2-yl)-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 115094617 |
| Molecular Formula | C9H12O3S |
| Molecular Weight | 200.26 g/mol |
| Exact Mass | 200.05 |
| IUPAC Name | [2-(5-methylthiophen-2-yl)-1,3-dioxolan-4-yl]methanol |
| SMILES | Cc1ccc(C2OCC(CO)O2)s1 |
| InChI | InChI=1S/C9H12O3S/c1-6-2-3-8(13-6)9-11-5-7(4-10)12-9/h2-3,7,9-10H,4-5H2,1H3 |
| InChIKey | KSSFWSCWGORCJJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.26 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |