C9H10O5 — CID 115094622
2-(5-methylfuran-2-yl)-1,3-dioxolane-4-carboxylic acid (PubChem CID 115094622) has the molecular formula C9H10O5 and a molecular weight of 198.17 g/mol. Its IUPAC name is 2-(5-methylfuran-2-yl)-1,3-dioxolane-4-carboxylic acid.
| Compound Name | 2-(5-methylfuran-2-yl)-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 115094622 |
| Molecular Formula | C9H10O5 |
| Molecular Weight | 198.17 g/mol |
| Exact Mass | 198.05 |
| IUPAC Name | 2-(5-methylfuran-2-yl)-1,3-dioxolane-4-carboxylic acid |
| SMILES | Cc1ccc(C2OCC(C(=O)O)O2)o1 |
| InChI | InChI=1S/C9H10O5/c1-5-2-3-6(13-5)9-12-4-7(14-9)8(10)11/h2-3,7,9H,4H2,1H3,(H,10,11) |
| InChIKey | XBVKFEBRHMBEQQ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.17 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |