About 6-fluoro-2-methyl-4-propan-2-yl-2,3-dihydro-1H-quinoxaline
6-fluoro-2-methyl-4-propan-2-yl-2,3-dihydro-1H-quinoxaline (PubChem CID 115095185) has the molecular formula C12H17FN2
and a molecular weight of 208.28 g/mol. Its IUPAC name is 6-fluoro-2-methyl-4-propan-2-yl-2,3-dihydro-1H-quinoxaline.
Molecular Properties
| Compound Name | 6-fluoro-2-methyl-4-propan-2-yl-2,3-dihydro-1H-quinoxaline |
| PubChem CID | 115095185 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | 6-fluoro-2-methyl-4-propan-2-yl-2,3-dihydro-1H-quinoxaline |
| SMILES | CC1CN(C(C)C)c2cc(F)ccc2N1 |
| InChI | InChI=1S/C12H17FN2/c1-8(2)15-7-9(3)14-11-5-4-10(13)6-12(11)15/h4-6,8-9,14H,7H2,1-3H3 |
| InChIKey | RLSFGYRWWMSOEW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-2-methyl-4-propan-2-yl-2,3-dihydro-1H-quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2-methyl-4-propan-2-yl-2,3-dihydro-1H-quinoxaline?
The IUPAC name of 6-fluoro-2-methyl-4-propan-2-yl-2,3-dihydro-1H-quinoxaline (CID 115095185) is 6-fluoro-2-methyl-4-propan-2-yl-2,3-dihydro-1H-quinoxaline.
What is the SMILES notation for 6-fluoro-2-methyl-4-propan-2-yl-2,3-dihydro-1H-quinoxaline?
The canonical SMILES for 6-fluoro-2-methyl-4-propan-2-yl-2,3-dihydro-1H-quinoxaline is CC1CN(C(C)C)c2cc(F)ccc2N1.
What is the InChIKey of 6-fluoro-2-methyl-4-propan-2-yl-2,3-dihydro-1H-quinoxaline?
The InChIKey is RLSFGYRWWMSOEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17FN2/c1-8(2)15-7-9(3)14-11-5-4-10(13)6-12(11)15/h4-6,8-9,14H,7H2,1-3H3.
What are the key properties of 6-fluoro-2-methyl-4-propan-2-yl-2,3-dihydro-1H-quinoxaline?
6-fluoro-2-methyl-4-propan-2-yl-2,3-dihydro-1H-quinoxaline has a molecular weight of 208.28 g/mol, XLogP of 2.85, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2-methyl-4-propan-2-yl-2,3-dihydro-1H-quinoxaline is sourced from PubChem (CID 115095185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).