About 3,3,6-trimethyl-4H-1,4-benzoxazin-2-one
3,3,6-trimethyl-4H-1,4-benzoxazin-2-one (PubChem CID 115095300) has the molecular formula C11H13NO2
and a molecular weight of 191.23 g/mol. Its IUPAC name is 3,3,6-trimethyl-4H-1,4-benzoxazin-2-one.
Molecular Properties
| Compound Name | 3,3,6-trimethyl-4H-1,4-benzoxazin-2-one |
| PubChem CID | 115095300 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 3,3,6-trimethyl-4H-1,4-benzoxazin-2-one |
| SMILES | Cc1ccc2c(c1)NC(C)(C)C(=O)O2 |
| InChI | InChI=1S/C11H13NO2/c1-7-4-5-9-8(6-7)12-11(2,3)10(13)14-9/h4-6,12H,1-3H3 |
| InChIKey | CZXMWDHLNRMIDC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3,3,6-trimethyl-4H-1,4-benzoxazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3,6-trimethyl-4H-1,4-benzoxazin-2-one?
The IUPAC name of 3,3,6-trimethyl-4H-1,4-benzoxazin-2-one (CID 115095300) is 3,3,6-trimethyl-4H-1,4-benzoxazin-2-one.
What is the SMILES notation for 3,3,6-trimethyl-4H-1,4-benzoxazin-2-one?
The canonical SMILES for 3,3,6-trimethyl-4H-1,4-benzoxazin-2-one is Cc1ccc2c(c1)NC(C)(C)C(=O)O2.
What is the InChIKey of 3,3,6-trimethyl-4H-1,4-benzoxazin-2-one?
The InChIKey is CZXMWDHLNRMIDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO2/c1-7-4-5-9-8(6-7)12-11(2,3)10(13)14-9/h4-6,12H,1-3H3.
What are the key properties of 3,3,6-trimethyl-4H-1,4-benzoxazin-2-one?
3,3,6-trimethyl-4H-1,4-benzoxazin-2-one has a molecular weight of 191.23 g/mol, XLogP of 2.10, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3,6-trimethyl-4H-1,4-benzoxazin-2-one is sourced from PubChem (CID 115095300), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).