C11H13NO2 — CID 115095300
3,3,6-trimethyl-4H-1,4-benzoxazin-2-one (PubChem CID 115095300) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 3,3,6-trimethyl-4H-1,4-benzoxazin-2-one.
| Compound Name | 3,3,6-trimethyl-4H-1,4-benzoxazin-2-one |
|---|---|
| PubChem CID | 115095300 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 3,3,6-trimethyl-4H-1,4-benzoxazin-2-one |
| SMILES | Cc1ccc2c(c1)NC(C)(C)C(=O)O2 |
| InChI | InChI=1S/C11H13NO2/c1-7-4-5-9-8(6-7)12-11(2,3)10(13)14-9/h4-6,12H,1-3H3 |
| InChIKey | CZXMWDHLNRMIDC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|