About 5-hydroxy-3,3,4-trimethyl-1H-quinoxalin-2-one
5-hydroxy-3,3,4-trimethyl-1H-quinoxalin-2-one (PubChem CID 115095429) has the molecular formula C11H14N2O2
and a molecular weight of 206.24 g/mol. Its IUPAC name is 5-hydroxy-3,3,4-trimethyl-1H-quinoxalin-2-one.
Molecular Properties
| Compound Name | 5-hydroxy-3,3,4-trimethyl-1H-quinoxalin-2-one |
| PubChem CID | 115095429 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | 5-hydroxy-3,3,4-trimethyl-1H-quinoxalin-2-one |
| SMILES | CN1c2c(O)cccc2NC(=O)C1(C)C |
| InChI | InChI=1S/C11H14N2O2/c1-11(2)10(15)12-7-5-4-6-8(14)9(7)13(11)3/h4-6,14H,1-3H3,(H,12,15) |
| InChIKey | RRSVHZFKZXCWDH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-hydroxy-3,3,4-trimethyl-1H-quinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-3,3,4-trimethyl-1H-quinoxalin-2-one?
The IUPAC name of 5-hydroxy-3,3,4-trimethyl-1H-quinoxalin-2-one (CID 115095429) is 5-hydroxy-3,3,4-trimethyl-1H-quinoxalin-2-one.
What is the SMILES notation for 5-hydroxy-3,3,4-trimethyl-1H-quinoxalin-2-one?
The canonical SMILES for 5-hydroxy-3,3,4-trimethyl-1H-quinoxalin-2-one is CN1c2c(O)cccc2NC(=O)C1(C)C.
What is the InChIKey of 5-hydroxy-3,3,4-trimethyl-1H-quinoxalin-2-one?
The InChIKey is RRSVHZFKZXCWDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O2/c1-11(2)10(15)12-7-5-4-6-8(14)9(7)13(11)3/h4-6,14H,1-3H3,(H,12,15).
What are the key properties of 5-hydroxy-3,3,4-trimethyl-1H-quinoxalin-2-one?
5-hydroxy-3,3,4-trimethyl-1H-quinoxalin-2-one has a molecular weight of 206.24 g/mol, XLogP of 1.56, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-3,3,4-trimethyl-1H-quinoxalin-2-one is sourced from PubChem (CID 115095429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).