C10H12ClNO — CID 115095511
5-chloro-2,2-dimethyl-3,4-dihydro-1,4-benzoxazine (PubChem CID 115095511) has the molecular formula C10H12ClNO and a molecular weight of 197.66 g/mol. Its IUPAC name is 5-chloro-2,2-dimethyl-3,4-dihydro-1,4-benzoxazine.
| Compound Name | 5-chloro-2,2-dimethyl-3,4-dihydro-1,4-benzoxazine |
|---|---|
| PubChem CID | 115095511 |
| Molecular Formula | C10H12ClNO |
| Molecular Weight | 197.66 g/mol |
| Exact Mass | 197.06 |
| IUPAC Name | 5-chloro-2,2-dimethyl-3,4-dihydro-1,4-benzoxazine |
| SMILES | CC1(C)CNc2c(Cl)cccc2O1 |
| InChI | InChI=1S/C10H12ClNO/c1-10(2)6-12-9-7(11)4-3-5-8(9)13-10/h3-5,12H,6H2,1-2H3 |
| InChIKey | SFYQBCKWPRIXEC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.66 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |