About 2-(4-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]benzothiazole;hydrobromide
2-(4-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]benzothiazole;hydrobromide (PubChem CID 11509559) has the molecular formula C19H18BrN3S
and a molecular weight of 400.35 g/mol. Its IUPAC name is 2-(4-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]benzothiazole;hydrobromide.
Molecular Properties
| Compound Name | 2-(4-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]benzothiazole;hydrobromide |
| PubChem CID | 11509559 |
| Molecular Formula | C19H18BrN3S |
| Molecular Weight | 400.35 g/mol |
| Exact Mass | 399.04 |
| IUPAC Name | 2-(4-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]benzothiazole;hydrobromide |
| SMILES | Br.c1ccc2c(c1)sc1nc(-c3ccc(N4CCCC4)cc3)cn12 |
| InChI | InChI=1S/C19H17N3S.BrH/c1-2-6-18-17(5-1)22-13-16(20-19(22)23-18)14-7-9-15(10-8-14)21-11-3-4-12-21;/h1-2,5-10,13H,3-4,11-12H2;1H |
| InChIKey | SDWNVYGHFHNRBJ-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 20.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.35 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(4-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]benzothiazole;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]benzothiazole;hydrobromide?
The IUPAC name of 2-(4-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]benzothiazole;hydrobromide (CID 11509559) is 2-(4-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]benzothiazole;hydrobromide.
What is the SMILES notation for 2-(4-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]benzothiazole;hydrobromide?
The canonical SMILES for 2-(4-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]benzothiazole;hydrobromide is Br.c1ccc2c(c1)sc1nc(-c3ccc(N4CCCC4)cc3)cn12.
What is the InChIKey of 2-(4-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]benzothiazole;hydrobromide?
The InChIKey is SDWNVYGHFHNRBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N3S.BrH/c1-2-6-18-17(5-1)22-13-16(20-19(22)23-18)14-7-9-15(10-8-14)21-11-3-4-12-21;/h1-2,5-10,13H,3-4,11-12H2;1H.
What are the key properties of 2-(4-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]benzothiazole;hydrobromide?
2-(4-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]benzothiazole;hydrobromide has a molecular weight of 400.35 g/mol, XLogP of 5.39, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-pyrrolidin-1-ylphenyl)imidazo[2,1-b][1,3]benzothiazole;hydrobromide is sourced from PubChem (CID 11509559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).