About 7-(hydroxymethyl)-3-methyl-3,4-dihydro-1,4-benzothiazin-2-one
7-(hydroxymethyl)-3-methyl-3,4-dihydro-1,4-benzothiazin-2-one (PubChem CID 115096148) has the molecular formula C10H11NO2S
and a molecular weight of 209.27 g/mol. Its IUPAC name is 7-(hydroxymethyl)-3-methyl-3,4-dihydro-1,4-benzothiazin-2-one.
Molecular Properties
| Compound Name | 7-(hydroxymethyl)-3-methyl-3,4-dihydro-1,4-benzothiazin-2-one |
| PubChem CID | 115096148 |
| Molecular Formula | C10H11NO2S |
| Molecular Weight | 209.27 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 7-(hydroxymethyl)-3-methyl-3,4-dihydro-1,4-benzothiazin-2-one |
| SMILES | CC1Nc2ccc(CO)cc2SC1=O |
| InChI | InChI=1S/C10H11NO2S/c1-6-10(13)14-9-4-7(5-12)2-3-8(9)11-6/h2-4,6,11-12H,5H2,1H3 |
| InChIKey | PFFMYJHVOFIHQD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.27 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 7-(hydroxymethyl)-3-methyl-3,4-dihydro-1,4-benzothiazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(hydroxymethyl)-3-methyl-3,4-dihydro-1,4-benzothiazin-2-one?
The IUPAC name of 7-(hydroxymethyl)-3-methyl-3,4-dihydro-1,4-benzothiazin-2-one (CID 115096148) is 7-(hydroxymethyl)-3-methyl-3,4-dihydro-1,4-benzothiazin-2-one.
What is the SMILES notation for 7-(hydroxymethyl)-3-methyl-3,4-dihydro-1,4-benzothiazin-2-one?
The canonical SMILES for 7-(hydroxymethyl)-3-methyl-3,4-dihydro-1,4-benzothiazin-2-one is CC1Nc2ccc(CO)cc2SC1=O.
What is the InChIKey of 7-(hydroxymethyl)-3-methyl-3,4-dihydro-1,4-benzothiazin-2-one?
The InChIKey is PFFMYJHVOFIHQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2S/c1-6-10(13)14-9-4-7(5-12)2-3-8(9)11-6/h2-4,6,11-12H,5H2,1H3.
What are the key properties of 7-(hydroxymethyl)-3-methyl-3,4-dihydro-1,4-benzothiazin-2-one?
7-(hydroxymethyl)-3-methyl-3,4-dihydro-1,4-benzothiazin-2-one has a molecular weight of 209.27 g/mol, XLogP of 1.61, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(hydroxymethyl)-3-methyl-3,4-dihydro-1,4-benzothiazin-2-one is sourced from PubChem (CID 115096148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).