About (4-ethyl-3-methyl-2,3-dihydro-1H-quinoxalin-5-yl)methanamine
(4-ethyl-3-methyl-2,3-dihydro-1H-quinoxalin-5-yl)methanamine (PubChem CID 115096491) has the molecular formula C12H19N3
and a molecular weight of 205.31 g/mol. Its IUPAC name is (4-ethyl-3-methyl-2,3-dihydro-1H-quinoxalin-5-yl)methanamine.
Molecular Properties
| Compound Name | (4-ethyl-3-methyl-2,3-dihydro-1H-quinoxalin-5-yl)methanamine |
| PubChem CID | 115096491 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.31 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | (4-ethyl-3-methyl-2,3-dihydro-1H-quinoxalin-5-yl)methanamine |
| SMILES | CCN1c2c(CN)cccc2NCC1C |
| InChI | InChI=1S/C12H19N3/c1-3-15-9(2)8-14-11-6-4-5-10(7-13)12(11)15/h4-6,9,14H,3,7-8,13H2,1-2H3 |
| InChIKey | QRHQWGAXCFYHJR-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-ethyl-3-methyl-2,3-dihydro-1H-quinoxalin-5-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethyl-3-methyl-2,3-dihydro-1H-quinoxalin-5-yl)methanamine?
The IUPAC name of (4-ethyl-3-methyl-2,3-dihydro-1H-quinoxalin-5-yl)methanamine (CID 115096491) is (4-ethyl-3-methyl-2,3-dihydro-1H-quinoxalin-5-yl)methanamine.
What is the SMILES notation for (4-ethyl-3-methyl-2,3-dihydro-1H-quinoxalin-5-yl)methanamine?
The canonical SMILES for (4-ethyl-3-methyl-2,3-dihydro-1H-quinoxalin-5-yl)methanamine is CCN1c2c(CN)cccc2NCC1C.
What is the InChIKey of (4-ethyl-3-methyl-2,3-dihydro-1H-quinoxalin-5-yl)methanamine?
The InChIKey is QRHQWGAXCFYHJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3/c1-3-15-9(2)8-14-11-6-4-5-10(7-13)12(11)15/h4-6,9,14H,3,7-8,13H2,1-2H3.
What are the key properties of (4-ethyl-3-methyl-2,3-dihydro-1H-quinoxalin-5-yl)methanamine?
(4-ethyl-3-methyl-2,3-dihydro-1H-quinoxalin-5-yl)methanamine has a molecular weight of 205.31 g/mol, XLogP of 1.79, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethyl-3-methyl-2,3-dihydro-1H-quinoxalin-5-yl)methanamine is sourced from PubChem (CID 115096491), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).