About 7-fluorospiro[4H-1,4-benzoxazine-2,1'-cyclobutane]-3-one
7-fluorospiro[4H-1,4-benzoxazine-2,1'-cyclobutane]-3-one (PubChem CID 115097478) has the molecular formula C11H10FNO2
and a molecular weight of 207.20 g/mol. Its IUPAC name is 7-fluorospiro[4H-1,4-benzoxazine-2,1'-cyclobutane]-3-one.
Molecular Properties
| Compound Name | 7-fluorospiro[4H-1,4-benzoxazine-2,1'-cyclobutane]-3-one |
| PubChem CID | 115097478 |
| Molecular Formula | C11H10FNO2 |
| Molecular Weight | 207.20 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 7-fluorospiro[4H-1,4-benzoxazine-2,1'-cyclobutane]-3-one |
| SMILES | O=C1Nc2ccc(F)cc2OC12CCC2 |
| InChI | InChI=1S/C11H10FNO2/c12-7-2-3-8-9(6-7)15-11(4-1-5-11)10(14)13-8/h2-3,6H,1,4-5H2,(H,13,14) |
| InChIKey | VWKGQLGZENLYTM-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.20 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-fluorospiro[4H-1,4-benzoxazine-2,1'-cyclobutane]-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluorospiro[4H-1,4-benzoxazine-2,1'-cyclobutane]-3-one?
The IUPAC name of 7-fluorospiro[4H-1,4-benzoxazine-2,1'-cyclobutane]-3-one (CID 115097478) is 7-fluorospiro[4H-1,4-benzoxazine-2,1'-cyclobutane]-3-one.
What is the SMILES notation for 7-fluorospiro[4H-1,4-benzoxazine-2,1'-cyclobutane]-3-one?
The canonical SMILES for 7-fluorospiro[4H-1,4-benzoxazine-2,1'-cyclobutane]-3-one is O=C1Nc2ccc(F)cc2OC12CCC2.
What is the InChIKey of 7-fluorospiro[4H-1,4-benzoxazine-2,1'-cyclobutane]-3-one?
The InChIKey is VWKGQLGZENLYTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10FNO2/c12-7-2-3-8-9(6-7)15-11(4-1-5-11)10(14)13-8/h2-3,6H,1,4-5H2,(H,13,14).
What are the key properties of 7-fluorospiro[4H-1,4-benzoxazine-2,1'-cyclobutane]-3-one?
7-fluorospiro[4H-1,4-benzoxazine-2,1'-cyclobutane]-3-one has a molecular weight of 207.20 g/mol, XLogP of 2.08, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluorospiro[4H-1,4-benzoxazine-2,1'-cyclobutane]-3-one is sourced from PubChem (CID 115097478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).