C12H15NS — CID 115097599
spiro[3,4-dihydro-1,4-benzothiazine-2,1'-cyclopentane] (PubChem CID 115097599) has the molecular formula C12H15NS and a molecular weight of 205.33 g/mol. Its IUPAC name is spiro[3,4-dihydro-1,4-benzothiazine-2,1'-cyclopentane].
| Compound Name | spiro[3,4-dihydro-1,4-benzothiazine-2,1'-cyclopentane] |
|---|---|
| PubChem CID | 115097599 |
| Molecular Formula | C12H15NS |
| Molecular Weight | 205.33 g/mol |
| Exact Mass | 205.09 |
| IUPAC Name | spiro[3,4-dihydro-1,4-benzothiazine-2,1'-cyclopentane] |
| SMILES | c1ccc2c(c1)NCC1(CCCC1)S2 |
| InChI | InChI=1S/C12H15NS/c1-2-6-11-10(5-1)13-9-12(14-11)7-3-4-8-12/h1-2,5-6,13H,3-4,7-9H2 |
| InChIKey | MXPNGQICUWEMQU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.33 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |