About 4-methyl-5-(trifluoromethyl)spiro[1,2-dihydroquinoxaline-3,1'-cyclohexane]
4-methyl-5-(trifluoromethyl)spiro[1,2-dihydroquinoxaline-3,1'-cyclohexane] (PubChem CID 115097937) has the molecular formula C15H19F3N2
and a molecular weight of 284.32 g/mol. Its IUPAC name is 4-methyl-5-(trifluoromethyl)spiro[1,2-dihydroquinoxaline-3,1'-cyclohexane].
Molecular Properties
| Compound Name | 4-methyl-5-(trifluoromethyl)spiro[1,2-dihydroquinoxaline-3,1'-cyclohexane] |
| PubChem CID | 115097937 |
| Molecular Formula | C15H19F3N2 |
| Molecular Weight | 284.32 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | 4-methyl-5-(trifluoromethyl)spiro[1,2-dihydroquinoxaline-3,1'-cyclohexane] |
| SMILES | CN1c2c(cccc2C(F)(F)F)NCC12CCCCC2 |
| InChI | InChI=1S/C15H19F3N2/c1-20-13-11(15(16,17)18)6-5-7-12(13)19-10-14(20)8-3-2-4-9-14/h5-7,19H,2-4,8-10H2,1H3 |
| InChIKey | BMRWFTMELOESIO-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.32 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-methyl-5-(trifluoromethyl)spiro[1,2-dihydroquinoxaline-3,1'-cyclohexane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5-(trifluoromethyl)spiro[1,2-dihydroquinoxaline-3,1'-cyclohexane]?
The IUPAC name of 4-methyl-5-(trifluoromethyl)spiro[1,2-dihydroquinoxaline-3,1'-cyclohexane] (CID 115097937) is 4-methyl-5-(trifluoromethyl)spiro[1,2-dihydroquinoxaline-3,1'-cyclohexane].
What is the SMILES notation for 4-methyl-5-(trifluoromethyl)spiro[1,2-dihydroquinoxaline-3,1'-cyclohexane]?
The canonical SMILES for 4-methyl-5-(trifluoromethyl)spiro[1,2-dihydroquinoxaline-3,1'-cyclohexane] is CN1c2c(cccc2C(F)(F)F)NCC12CCCCC2.
What is the InChIKey of 4-methyl-5-(trifluoromethyl)spiro[1,2-dihydroquinoxaline-3,1'-cyclohexane]?
The InChIKey is BMRWFTMELOESIO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19F3N2/c1-20-13-11(15(16,17)18)6-5-7-12(13)19-10-14(20)8-3-2-4-9-14/h5-7,19H,2-4,8-10H2,1H3.
What are the key properties of 4-methyl-5-(trifluoromethyl)spiro[1,2-dihydroquinoxaline-3,1'-cyclohexane]?
4-methyl-5-(trifluoromethyl)spiro[1,2-dihydroquinoxaline-3,1'-cyclohexane] has a molecular weight of 284.32 g/mol, XLogP of 4.27, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5-(trifluoromethyl)spiro[1,2-dihydroquinoxaline-3,1'-cyclohexane] is sourced from PubChem (CID 115097937), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).