About 6-(trifluoromethyl)-3,5-dihydro-2H-1,5-benzoxazepin-4-one
6-(trifluoromethyl)-3,5-dihydro-2H-1,5-benzoxazepin-4-one (PubChem CID 115098323) has the molecular formula C10H8F3NO2
and a molecular weight of 231.17 g/mol. Its IUPAC name is 6-(trifluoromethyl)-3,5-dihydro-2H-1,5-benzoxazepin-4-one.
Molecular Properties
| Compound Name | 6-(trifluoromethyl)-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
| PubChem CID | 115098323 |
| Molecular Formula | C10H8F3NO2 |
| Molecular Weight | 231.17 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 6-(trifluoromethyl)-3,5-dihydro-2H-1,5-benzoxazepin-4-one |
| SMILES | O=C1CCOc2cccc(C(F)(F)F)c2N1 |
| InChI | InChI=1S/C10H8F3NO2/c11-10(12,13)6-2-1-3-7-9(6)14-8(15)4-5-16-7/h1-3H,4-5H2,(H,14,15) |
| InChIKey | AIGXOHUJYGERBB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.17 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-(trifluoromethyl)-3,5-dihydro-2H-1,5-benzoxazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(trifluoromethyl)-3,5-dihydro-2H-1,5-benzoxazepin-4-one?
The IUPAC name of 6-(trifluoromethyl)-3,5-dihydro-2H-1,5-benzoxazepin-4-one (CID 115098323) is 6-(trifluoromethyl)-3,5-dihydro-2H-1,5-benzoxazepin-4-one.
What is the SMILES notation for 6-(trifluoromethyl)-3,5-dihydro-2H-1,5-benzoxazepin-4-one?
The canonical SMILES for 6-(trifluoromethyl)-3,5-dihydro-2H-1,5-benzoxazepin-4-one is O=C1CCOc2cccc(C(F)(F)F)c2N1.
What is the InChIKey of 6-(trifluoromethyl)-3,5-dihydro-2H-1,5-benzoxazepin-4-one?
The InChIKey is AIGXOHUJYGERBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3NO2/c11-10(12,13)6-2-1-3-7-9(6)14-8(15)4-5-16-7/h1-3H,4-5H2,(H,14,15).
What are the key properties of 6-(trifluoromethyl)-3,5-dihydro-2H-1,5-benzoxazepin-4-one?
6-(trifluoromethyl)-3,5-dihydro-2H-1,5-benzoxazepin-4-one has a molecular weight of 231.17 g/mol, XLogP of 2.43, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(trifluoromethyl)-3,5-dihydro-2H-1,5-benzoxazepin-4-one is sourced from PubChem (CID 115098323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).