C11H12BrNOS — CID 115098459
7-bromo-3,3-dimethyl-2,5-dihydro-1,5-benzothiazepin-4-one (PubChem CID 115098459) has the molecular formula C11H12BrNOS and a molecular weight of 286.19 g/mol. Its IUPAC name is 7-bromo-3,3-dimethyl-2,5-dihydro-1,5-benzothiazepin-4-one.
| Compound Name | 7-bromo-3,3-dimethyl-2,5-dihydro-1,5-benzothiazepin-4-one |
|---|---|
| PubChem CID | 115098459 |
| Molecular Formula | C11H12BrNOS |
| Molecular Weight | 286.19 g/mol |
| Exact Mass | 284.98 |
| IUPAC Name | 7-bromo-3,3-dimethyl-2,5-dihydro-1,5-benzothiazepin-4-one |
| SMILES | CC1(C)CSc2ccc(Br)cc2NC1=O |
| InChI | InChI=1S/C11H12BrNOS/c1-11(2)6-15-9-4-3-7(12)5-8(9)13-10(11)14/h3-5H,6H2,1-2H3,(H,13,14) |
| InChIKey | JRVKQHZBLHITRR-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.19 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |