C12H16N2O — CID 115098473
1,3,7-trimethyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one (PubChem CID 115098473) has the molecular formula C12H16N2O and a molecular weight of 204.27 g/mol. Its IUPAC name is 1,3,7-trimethyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one.
| Compound Name | 1,3,7-trimethyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one |
|---|---|
| PubChem CID | 115098473 |
| Molecular Formula | C12H16N2O |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1,3,7-trimethyl-3,5-dihydro-2H-1,5-benzodiazepin-4-one |
| SMILES | Cc1ccc2c(c1)NC(=O)C(C)CN2C |
| InChI | InChI=1S/C12H16N2O/c1-8-4-5-11-10(6-8)13-12(15)9(2)7-14(11)3/h4-6,9H,7H2,1-3H3,(H,13,15) |
| InChIKey | MTSVAZDPESWQJE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |