About N,5-bis(4-fluorophenyl)-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-7-amine
N,5-bis(4-fluorophenyl)-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 11509910) has the molecular formula C21H19F2N5
and a molecular weight of 379.41 g/mol. Its IUPAC name is N,5-bis(4-fluorophenyl)-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-7-amine.
Molecular Properties
| Compound Name | N,5-bis(4-fluorophenyl)-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-7-amine |
| PubChem CID | 11509910 |
| Molecular Formula | C21H19F2N5 |
| Molecular Weight | 379.41 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | N,5-bis(4-fluorophenyl)-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCCc1nn(C)c2c(Nc3ccc(F)cc3)nc(-c3ccc(F)cc3)nc12 |
| InChI | InChI=1S/C21H19F2N5/c1-3-4-17-18-19(28(2)27-17)21(24-16-11-9-15(23)10-12-16)26-20(25-18)13-5-7-14(22)8-6-13/h5-12H,3-4H2,1-2H3,(H,24,25,26) |
| InChIKey | FYRFHCZRVNXPAS-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 379.41 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,5-bis(4-fluorophenyl)-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,5-bis(4-fluorophenyl)-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-7-amine?
The IUPAC name of N,5-bis(4-fluorophenyl)-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-7-amine (CID 11509910) is N,5-bis(4-fluorophenyl)-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-7-amine.
What is the SMILES notation for N,5-bis(4-fluorophenyl)-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-7-amine?
The canonical SMILES for N,5-bis(4-fluorophenyl)-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-7-amine is CCCc1nn(C)c2c(Nc3ccc(F)cc3)nc(-c3ccc(F)cc3)nc12.
What is the InChIKey of N,5-bis(4-fluorophenyl)-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-7-amine?
The InChIKey is FYRFHCZRVNXPAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19F2N5/c1-3-4-17-18-19(28(2)27-17)21(24-16-11-9-15(23)10-12-16)26-20(25-18)13-5-7-14(22)8-6-13/h5-12H,3-4H2,1-2H3,(H,24,25,26).
What are the key properties of N,5-bis(4-fluorophenyl)-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-7-amine?
N,5-bis(4-fluorophenyl)-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-7-amine has a molecular weight of 379.41 g/mol, XLogP of 5.00, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,5-bis(4-fluorophenyl)-1-methyl-3-propylpyrazolo[4,5-d]pyrimidin-7-amine is sourced from PubChem (CID 11509910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).