C14H18N2O2 — CID 115099669
7-hydroxy-5-methylspiro[1,4-dihydro-1,5-benzodiazepine-3,1'-cyclopentane]-2-one (PubChem CID 115099669) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 7-hydroxy-5-methylspiro[1,4-dihydro-1,5-benzodiazepine-3,1'-cyclopentane]-2-one.
| Compound Name | 7-hydroxy-5-methylspiro[1,4-dihydro-1,5-benzodiazepine-3,1'-cyclopentane]-2-one |
|---|---|
| PubChem CID | 115099669 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 7-hydroxy-5-methylspiro[1,4-dihydro-1,5-benzodiazepine-3,1'-cyclopentane]-2-one |
| SMILES | CN1CC2(CCCC2)C(=O)Nc2ccc(O)cc21 |
| InChI | InChI=1S/C14H18N2O2/c1-16-9-14(6-2-3-7-14)13(18)15-11-5-4-10(17)8-12(11)16/h4-5,8,17H,2-3,6-7,9H2,1H3,(H,15,18) |
| InChIKey | WUMLEOWKTGLPEF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|