C12H16N2O2S — CID 115099965
1,1-dioxospiro[4,5-dihydro-2H-1λ6,5-benzothiazepine-3,1'-cyclobutane]-7-amine (PubChem CID 115099965) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is 1,1-dioxospiro[4,5-dihydro-2H-1λ6,5-benzothiazepine-3,1'-cyclobutane]-7-amine.
| Compound Name | 1,1-dioxospiro[4,5-dihydro-2H-1λ6,5-benzothiazepine-3,1'-cyclobutane]-7-amine |
|---|---|
| PubChem CID | 115099965 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | 1,1-dioxospiro[4,5-dihydro-2H-1λ6,5-benzothiazepine-3,1'-cyclobutane]-7-amine |
| SMILES | Nc1ccc2c(c1)NCC1(CCC1)CS2(=O)=O |
| InChI | InChI=1S/C12H16N2O2S/c13-9-2-3-11-10(6-9)14-7-12(4-1-5-12)8-17(11,15)16/h2-3,6,14H,1,4-5,7-8,13H2 |
| InChIKey | SDTPTHYOFDIODL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|