C11H20N2OS — CID 115100428
4-(thian-4-ylmethyl)-1,4-diazepan-5-one (PubChem CID 115100428) has the molecular formula C11H20N2OS and a molecular weight of 228.36 g/mol. Its IUPAC name is 4-(thian-4-ylmethyl)-1,4-diazepan-5-one.
| Compound Name | 4-(thian-4-ylmethyl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 115100428 |
| Molecular Formula | C11H20N2OS |
| Molecular Weight | 228.36 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 4-(thian-4-ylmethyl)-1,4-diazepan-5-one |
| SMILES | O=C1CCNCCN1CC1CCSCC1 |
| InChI | InChI=1S/C11H20N2OS/c14-11-1-4-12-5-6-13(11)9-10-2-7-15-8-3-10/h10,12H,1-9H2 |
| InChIKey | BRHYKNCPTXOZRX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |