About 4-(oxolan-2-yl)-1,4-diazepan-5-one
4-(oxolan-2-yl)-1,4-diazepan-5-one (PubChem CID 115100440) has the molecular formula C9H16N2O2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 4-(oxolan-2-yl)-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 4-(oxolan-2-yl)-1,4-diazepan-5-one |
| PubChem CID | 115100440 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 4-(oxolan-2-yl)-1,4-diazepan-5-one |
| SMILES | O=C1CCNCCN1C1CCCO1 |
| InChI | InChI=1S/C9H16N2O2/c12-8-3-4-10-5-6-11(8)9-2-1-7-13-9/h9-10H,1-7H2 |
| InChIKey | NXOSLGBLWKKYEE-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(oxolan-2-yl)-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(oxolan-2-yl)-1,4-diazepan-5-one?
The IUPAC name of 4-(oxolan-2-yl)-1,4-diazepan-5-one (CID 115100440) is 4-(oxolan-2-yl)-1,4-diazepan-5-one.
What is the SMILES notation for 4-(oxolan-2-yl)-1,4-diazepan-5-one?
The canonical SMILES for 4-(oxolan-2-yl)-1,4-diazepan-5-one is O=C1CCNCCN1C1CCCO1.
What is the InChIKey of 4-(oxolan-2-yl)-1,4-diazepan-5-one?
The InChIKey is NXOSLGBLWKKYEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2O2/c12-8-3-4-10-5-6-11(8)9-2-1-7-13-9/h9-10H,1-7H2.
What are the key properties of 4-(oxolan-2-yl)-1,4-diazepan-5-one?
4-(oxolan-2-yl)-1,4-diazepan-5-one has a molecular weight of 184.24 g/mol, XLogP of -0.06, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(oxolan-2-yl)-1,4-diazepan-5-one is sourced from PubChem (CID 115100440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).