About 4-pyridin-4-yl-1,4-diazepan-5-one
4-pyridin-4-yl-1,4-diazepan-5-one (PubChem CID 115100494) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 4-pyridin-4-yl-1,4-diazepan-5-one.
Molecular Properties
| Compound Name | 4-pyridin-4-yl-1,4-diazepan-5-one |
| PubChem CID | 115100494 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 4-pyridin-4-yl-1,4-diazepan-5-one |
| SMILES | O=C1CCNCCN1c1ccncc1 |
| InChI | InChI=1S/C10H13N3O/c14-10-3-6-12-7-8-13(10)9-1-4-11-5-2-9/h1-2,4-5,12H,3,6-8H2 |
| InChIKey | BCXALELDQNELMU-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-pyridin-4-yl-1,4-diazepan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-pyridin-4-yl-1,4-diazepan-5-one?
The IUPAC name of 4-pyridin-4-yl-1,4-diazepan-5-one (CID 115100494) is 4-pyridin-4-yl-1,4-diazepan-5-one.
What is the SMILES notation for 4-pyridin-4-yl-1,4-diazepan-5-one?
The canonical SMILES for 4-pyridin-4-yl-1,4-diazepan-5-one is O=C1CCNCCN1c1ccncc1.
What is the InChIKey of 4-pyridin-4-yl-1,4-diazepan-5-one?
The InChIKey is BCXALELDQNELMU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c14-10-3-6-12-7-8-13(10)9-1-4-11-5-2-9/h1-2,4-5,12H,3,6-8H2.
What are the key properties of 4-pyridin-4-yl-1,4-diazepan-5-one?
4-pyridin-4-yl-1,4-diazepan-5-one has a molecular weight of 191.23 g/mol, XLogP of 0.41, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-pyridin-4-yl-1,4-diazepan-5-one is sourced from PubChem (CID 115100494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).