C12H12ClF3N2O — CID 115101451
4-[(2-chlorophenyl)methyl]-5-(trifluoromethyl)piperazin-2-one (PubChem CID 115101451) has the molecular formula C12H12ClF3N2O and a molecular weight of 292.69 g/mol. Its IUPAC name is 4-[(2-chlorophenyl)methyl]-5-(trifluoromethyl)piperazin-2-one.
| Compound Name | 4-[(2-chlorophenyl)methyl]-5-(trifluoromethyl)piperazin-2-one |
|---|---|
| PubChem CID | 115101451 |
| Molecular Formula | C12H12ClF3N2O |
| Molecular Weight | 292.69 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | 4-[(2-chlorophenyl)methyl]-5-(trifluoromethyl)piperazin-2-one |
| SMILES | O=C1CN(Cc2ccccc2Cl)C(C(F)(F)F)CN1 |
| InChI | InChI=1S/C12H12ClF3N2O/c13-9-4-2-1-3-8(9)6-18-7-11(19)17-5-10(18)12(14,15)16/h1-4,10H,5-7H2,(H,17,19) |
| InChIKey | IBFQPXVWRPHHHB-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.69 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |