About 2-[[1-(2,4-dimethoxyphenyl)-3-(4-fluorobenzoyl)-6-oxo-2-pyridinyl]amino]acetic acid
2-[[1-(2,4-dimethoxyphenyl)-3-(4-fluorobenzoyl)-6-oxo-2-pyridinyl]amino]acetic acid (PubChem CID 11510151) has the molecular formula C22H19FN2O6
and a molecular weight of 426.40 g/mol. Its IUPAC name is 2-[[1-(2,4-dimethoxyphenyl)-3-(4-fluorobenzoyl)-6-oxo-2-pyridinyl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[[1-(2,4-dimethoxyphenyl)-3-(4-fluorobenzoyl)-6-oxo-2-pyridinyl]amino]acetic acid |
| PubChem CID | 11510151 |
| Molecular Formula | C22H19FN2O6 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2-[[1-(2,4-dimethoxyphenyl)-3-(4-fluorobenzoyl)-6-oxo-2-pyridinyl]amino]acetic acid |
| SMILES | COc1ccc(-n2c(NCC(=O)O)c(C(=O)c3ccc(F)cc3)ccc2=O)c(OC)c1 |
| InChI | InChI=1S/C22H19FN2O6/c1-30-15-7-9-17(18(11-15)31-2)25-19(26)10-8-16(22(25)24-12-20(27)28)21(29)13-3-5-14(23)6-4-13/h3-11,24H,12H2,1-2H3,(H,27,28) |
| InChIKey | UGSQCMPKWLUDKC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 106.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-[[1-(2,4-dimethoxyphenyl)-3-(4-fluorobenzoyl)-6-oxo-2-pyridinyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[1-(2,4-dimethoxyphenyl)-3-(4-fluorobenzoyl)-6-oxo-2-pyridinyl]amino]acetic acid?
The IUPAC name of 2-[[1-(2,4-dimethoxyphenyl)-3-(4-fluorobenzoyl)-6-oxo-2-pyridinyl]amino]acetic acid (CID 11510151) is 2-[[1-(2,4-dimethoxyphenyl)-3-(4-fluorobenzoyl)-6-oxo-2-pyridinyl]amino]acetic acid.
What is the SMILES notation for 2-[[1-(2,4-dimethoxyphenyl)-3-(4-fluorobenzoyl)-6-oxo-2-pyridinyl]amino]acetic acid?
The canonical SMILES for 2-[[1-(2,4-dimethoxyphenyl)-3-(4-fluorobenzoyl)-6-oxo-2-pyridinyl]amino]acetic acid is COc1ccc(-n2c(NCC(=O)O)c(C(=O)c3ccc(F)cc3)ccc2=O)c(OC)c1.
What is the InChIKey of 2-[[1-(2,4-dimethoxyphenyl)-3-(4-fluorobenzoyl)-6-oxo-2-pyridinyl]amino]acetic acid?
The InChIKey is UGSQCMPKWLUDKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19FN2O6/c1-30-15-7-9-17(18(11-15)31-2)25-19(26)10-8-16(22(25)24-12-20(27)28)21(29)13-3-5-14(23)6-4-13/h3-11,24H,12H2,1-2H3,(H,27,28).
What are the key properties of 2-[[1-(2,4-dimethoxyphenyl)-3-(4-fluorobenzoyl)-6-oxo-2-pyridinyl]amino]acetic acid?
2-[[1-(2,4-dimethoxyphenyl)-3-(4-fluorobenzoyl)-6-oxo-2-pyridinyl]amino]acetic acid has a molecular weight of 426.40 g/mol, XLogP of 2.72, 8 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[1-(2,4-dimethoxyphenyl)-3-(4-fluorobenzoyl)-6-oxo-2-pyridinyl]amino]acetic acid is sourced from PubChem (CID 11510151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).