About 3-[2-(trifluoromethyl)-1,4-diazepan-1-yl]thiolane 1,1-dioxide
3-[2-(trifluoromethyl)-1,4-diazepan-1-yl]thiolane 1,1-dioxide (PubChem CID 115101628) has the molecular formula C10H17F3N2O2S
and a molecular weight of 286.32 g/mol. Its IUPAC name is 3-[2-(trifluoromethyl)-1,4-diazepan-1-yl]thiolane 1,1-dioxide.
Molecular Properties
| Compound Name | 3-[2-(trifluoromethyl)-1,4-diazepan-1-yl]thiolane 1,1-dioxide |
| PubChem CID | 115101628 |
| Molecular Formula | C10H17F3N2O2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 3-[2-(trifluoromethyl)-1,4-diazepan-1-yl]thiolane 1,1-dioxide |
| SMILES | O=S1(=O)CCC(N2CCCNCC2C(F)(F)F)C1 |
| InChI | InChI=1S/C10H17F3N2O2S/c11-10(12,13)9-6-14-3-1-4-15(9)8-2-5-18(16,17)7-8/h8-9,14H,1-7H2 |
| InChIKey | MDGAFPBHSZZRJT-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[2-(trifluoromethyl)-1,4-diazepan-1-yl]thiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(trifluoromethyl)-1,4-diazepan-1-yl]thiolane 1,1-dioxide?
The IUPAC name of 3-[2-(trifluoromethyl)-1,4-diazepan-1-yl]thiolane 1,1-dioxide (CID 115101628) is 3-[2-(trifluoromethyl)-1,4-diazepan-1-yl]thiolane 1,1-dioxide.
What is the SMILES notation for 3-[2-(trifluoromethyl)-1,4-diazepan-1-yl]thiolane 1,1-dioxide?
The canonical SMILES for 3-[2-(trifluoromethyl)-1,4-diazepan-1-yl]thiolane 1,1-dioxide is O=S1(=O)CCC(N2CCCNCC2C(F)(F)F)C1.
What is the InChIKey of 3-[2-(trifluoromethyl)-1,4-diazepan-1-yl]thiolane 1,1-dioxide?
The InChIKey is MDGAFPBHSZZRJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F3N2O2S/c11-10(12,13)9-6-14-3-1-4-15(9)8-2-5-18(16,17)7-8/h8-9,14H,1-7H2.
What are the key properties of 3-[2-(trifluoromethyl)-1,4-diazepan-1-yl]thiolane 1,1-dioxide?
3-[2-(trifluoromethyl)-1,4-diazepan-1-yl]thiolane 1,1-dioxide has a molecular weight of 286.32 g/mol, XLogP of 0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(trifluoromethyl)-1,4-diazepan-1-yl]thiolane 1,1-dioxide is sourced from PubChem (CID 115101628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).