C12H14F4N2 — CID 115101727
1-(3-fluorophenyl)-2-(trifluoromethyl)-1,4-diazepane (PubChem CID 115101727) has the molecular formula C12H14F4N2 and a molecular weight of 262.25 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-2-(trifluoromethyl)-1,4-diazepane.
| Compound Name | 1-(3-fluorophenyl)-2-(trifluoromethyl)-1,4-diazepane |
|---|---|
| PubChem CID | 115101727 |
| Molecular Formula | C12H14F4N2 |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 1-(3-fluorophenyl)-2-(trifluoromethyl)-1,4-diazepane |
| SMILES | Fc1cccc(N2CCCNCC2C(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F4N2/c13-9-3-1-4-10(7-9)18-6-2-5-17-8-11(18)12(14,15)16/h1,3-4,7,11,17H,2,5-6,8H2 |
| InChIKey | YKKJXNIBILHDDE-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |