C22H30FN7O — CID 11510177
5-(1,4-diazepan-1-yl)-1-(2-ethoxyethyl)-3-ethyl-N-(4-fluorophenyl)pyrazolo[4,5-d]pyrimidin-7-amine (PubChem CID 11510177) has the molecular formula C22H30FN7O and a molecular weight of 427.53 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-yl)-1-(2-ethoxyethyl)-3-ethyl-N-(4-fluorophenyl)pyrazolo[4,5-d]pyrimidin-7-amine.
| Compound Name | 5-(1,4-diazepan-1-yl)-1-(2-ethoxyethyl)-3-ethyl-N-(4-fluorophenyl)pyrazolo[4,5-d]pyrimidin-7-amine |
|---|---|
| PubChem CID | 11510177 |
| Molecular Formula | C22H30FN7O |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | 5-(1,4-diazepan-1-yl)-1-(2-ethoxyethyl)-3-ethyl-N-(4-fluorophenyl)pyrazolo[4,5-d]pyrimidin-7-amine |
| SMILES | CCOCCn1nc(CC)c2nc(N3CCCNCC3)nc(Nc3ccc(F)cc3)c21 |
| InChI | InChI=1S/C22H30FN7O/c1-3-18-19-20(30(28-18)14-15-31-4-2)21(25-17-8-6-16(23)7-9-17)27-22(26-19)29-12-5-10-24-11-13-29/h6-9,24H,3-5,10-15H2,1-2H3,(H,25,26,27) |
| InChIKey | GLMQUPDEVTYSIW-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|