C9H17N3O2 — CID 115102433
4-(aminomethyl)-3-piperidin-2-yl-1,3-oxazolidin-2-one (PubChem CID 115102433) has the molecular formula C9H17N3O2 and a molecular weight of 199.25 g/mol. Its IUPAC name is 4-(aminomethyl)-3-piperidin-2-yl-1,3-oxazolidin-2-one.
| Compound Name | 4-(aminomethyl)-3-piperidin-2-yl-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 115102433 |
| Molecular Formula | C9H17N3O2 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.13 |
| IUPAC Name | 4-(aminomethyl)-3-piperidin-2-yl-1,3-oxazolidin-2-one |
| SMILES | NCC1COC(=O)N1C1CCCCN1 |
| InChI | InChI=1S/C9H17N3O2/c10-5-7-6-14-9(13)12(7)8-3-1-2-4-11-8/h7-8,11H,1-6,10H2 |
| InChIKey | BXJOJQUVJQUWBB-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |