C24H32O7 — CID 11510297
(1R,2R,3S,4R,5R)-1-[5-[(4-ethylphenyl)methyl]-2,4-dimethoxyphenyl]-5-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol (PubChem CID 11510297) has the molecular formula C24H32O7 and a molecular weight of 432.51 g/mol. Its IUPAC name is (1R,2R,3S,4R,5R)-1-[5-[(4-ethylphenyl)methyl]-2,4-dimethoxyphenyl]-5-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol.
| Compound Name | (1R,2R,3S,4R,5R)-1-[5-[(4-ethylphenyl)methyl]-2,4-dimethoxyphenyl]-5-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 11510297 |
| Molecular Formula | C24H32O7 |
| Molecular Weight | 432.51 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | (1R,2R,3S,4R,5R)-1-[5-[(4-ethylphenyl)methyl]-2,4-dimethoxyphenyl]-5-(hydroxymethyl)cyclohexane-1,2,3,4-tetrol |
| SMILES | CCc1ccc(Cc2cc([C@]3(O)C[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(OC)cc2OC)cc1 |
| InChI | InChI=1S/C24H32O7/c1-4-14-5-7-15(8-6-14)9-16-10-18(20(31-3)11-19(16)30-2)24(29)12-17(13-25)21(26)22(27)23(24)28/h5-8,10-11,17,21-23,25-29H,4,9,12-13H2,1-3H3/t17-,21-,22+,23-,24-/m1/s1 |
| InChIKey | YBDASUYOOMCJRA-ASDZUOGYSA-N |
| XLogP | 1.14 |
| TPSA | 119.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.51 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |