C22H20F3NO3S — CID 11510367
3-[[4-[[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]methoxy]phenyl]methylamino]propanoic acid (PubChem CID 11510367) has the molecular formula C22H20F3NO3S and a molecular weight of 435.47 g/mol. Its IUPAC name is 3-[[4-[[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]methoxy]phenyl]methylamino]propanoic acid.
| Compound Name | 3-[[4-[[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]methoxy]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 11510367 |
| Molecular Formula | C22H20F3NO3S |
| Molecular Weight | 435.47 g/mol |
| Exact Mass | 435.11 |
| IUPAC Name | 3-[[4-[[4-phenyl-5-(trifluoromethyl)thiophen-2-yl]methoxy]phenyl]methylamino]propanoic acid |
| SMILES | O=C(O)CCNCc1ccc(OCc2cc(-c3ccccc3)c(C(F)(F)F)s2)cc1 |
| InChI | InChI=1S/C22H20F3NO3S/c23-22(24,25)21-19(16-4-2-1-3-5-16)12-18(30-21)14-29-17-8-6-15(7-9-17)13-26-11-10-20(27)28/h1-9,12,26H,10-11,13-14H2,(H,27,28) |
| InChIKey | IJBMPYLQDRXBRE-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.47 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|