C11H15NO2S — CID 115104290
4-(methylsulfonylmethyl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 115104290) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is 4-(methylsulfonylmethyl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 4-(methylsulfonylmethyl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 115104290 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | 4-(methylsulfonylmethyl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | CS(=O)(=O)CC1CNCc2ccccc21 |
| InChI | InChI=1S/C11H15NO2S/c1-15(13,14)8-10-7-12-6-9-4-2-3-5-11(9)10/h2-5,10,12H,6-8H2,1H3 |
| InChIKey | AZBLGQYTSNZZAW-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |